C6H4F6N2O — CID 162542058
1,1,1,3,3,3-hexafluoropropan-2-one;1H-pyrazole (PubChem CID 162542058) has the molecular formula C6H4F6N2O and a molecular weight of 234.10 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-one;1H-pyrazole.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-one;1H-pyrazole |
|---|---|
| PubChem CID | 162542058 |
| Molecular Formula | C6H4F6N2O |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-one;1H-pyrazole |
| SMILES | O=C(C(F)(F)F)C(F)(F)F.c1cn[nH]c1 |
| InChI | InChI=1S/C3F6O.C3H4N2/c4-2(5,6)1(10)3(7,8)9;1-2-4-5-3-1/h;1-3H,(H,4,5) |
| InChIKey | LWGNMQKWKBVRAD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |