C34H30F3N5O4S — CID 162543327
3-[[3-[[4-(3,6-dihydro-2H-pyridin-1-yl)-2-[[5-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]carbamoyl]phenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid (PubChem CID 162543327) has the molecular formula C34H30F3N5O4S and a molecular weight of 661.71 g/mol. Its IUPAC name is 3-[[3-[[4-(3,6-dihydro-2H-pyridin-1-yl)-2-[[5-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]carbamoyl]phenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[[4-(3,6-dihydro-2H-pyridin-1-yl)-2-[[5-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]carbamoyl]phenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 162543327 |
| Molecular Formula | C34H30F3N5O4S |
| Molecular Weight | 661.71 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | 3-[[3-[[4-(3,6-dihydro-2H-pyridin-1-yl)-2-[[5-[3-(trifluoromethyl)phenyl]pyrimidin-2-yl]carbamoyl]phenyl]carbamoyl]phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(C(=O)Nc2ccc(N3CC=CCC3)cc2C(=O)Nc2ncc(-c3cccc(C(F)(F)F)c3)cn2)c1 |
| InChI | InChI=1S/C34H30F3N5O4S/c35-34(36,37)26-9-5-7-23(17-26)25-19-38-33(39-20-25)41-32(46)28-18-27(42-13-2-1-3-14-42)10-11-29(28)40-31(45)24-8-4-6-22(16-24)21-47-15-12-30(43)44/h1-2,4-11,16-20H,3,12-15,21H2,(H,40,45)(H,43,44)(H,38,39,41,46) |
| InChIKey | PJBAIBMKHGQESH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|