C28H22F6O — CID 162544949
5-[(E)-1,2-difluoro-2-[4-(4-methylphenyl)-2-prop-2-enylphenyl]ethenyl]-1-fluoro-3-prop-2-enyl-2-(trifluoromethoxy)benzene (PubChem CID 162544949) has the molecular formula C28H22F6O and a molecular weight of 488.47 g/mol. Its IUPAC name is 5-[(E)-1,2-difluoro-2-[4-(4-methylphenyl)-2-prop-2-enylphenyl]ethenyl]-1-fluoro-3-prop-2-enyl-2-(trifluoromethoxy)benzene.
| Compound Name | 5-[(E)-1,2-difluoro-2-[4-(4-methylphenyl)-2-prop-2-enylphenyl]ethenyl]-1-fluoro-3-prop-2-enyl-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 162544949 |
| Molecular Formula | C28H22F6O |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 5-[(E)-1,2-difluoro-2-[4-(4-methylphenyl)-2-prop-2-enylphenyl]ethenyl]-1-fluoro-3-prop-2-enyl-2-(trifluoromethoxy)benzene |
| SMILES | C=CCc1cc(-c2ccc(C)cc2)ccc1/C(F)=C(\F)c1cc(F)c(OC(F)(F)F)c(CC=C)c1 |
| InChI | InChI=1S/C28H22F6O/c1-4-6-20-14-19(18-10-8-17(3)9-11-18)12-13-23(20)26(31)25(30)22-15-21(7-5-2)27(24(29)16-22)35-28(32,33)34/h4-5,8-16H,1-2,6-7H2,3H3/b26-25+ |
| InChIKey | PTLZPOIUPUGMJY-OCEACIFDSA-N |
| XLogP | 8.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|