C27H23F4N7O — CID 162545812
2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)phenyl]methylamino]-N-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 162545812) has the molecular formula C27H23F4N7O and a molecular weight of 537.52 g/mol. Its IUPAC name is 2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)phenyl]methylamino]-N-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)phenyl]methylamino]-N-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162545812 |
| Molecular Formula | C27H23F4N7O |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)phenyl]methylamino]-N-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | C=C/C(=C\C=C(/C)F)NC(=O)c1cc(C(F)(F)F)cnc1NCc1ccc(-c2ccc3c(N)ncnn23)cc1 |
| InChI | InChI=1S/C27H23F4N7O/c1-3-20(9-4-16(2)28)37-26(39)21-12-19(27(29,30)31)14-34-25(21)33-13-17-5-7-18(8-6-17)22-10-11-23-24(32)35-15-36-38(22)23/h3-12,14-15H,1,13H2,2H3,(H,33,34)(H,37,39)(H2,32,35,36)/b16-4+,20-9+ |
| InChIKey | JQCUNTYZCGSMCL-PPABPEAUSA-N |
| XLogP | 5.68 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|