C22H25F3N2O2 — CID 162546389
N-(cyclohexylmethyl)-5-[2-[3-(trifluoromethyl)phenyl]ethoxy]pyridine-2-carboxamide (PubChem CID 162546389) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5-[2-[3-(trifluoromethyl)phenyl]ethoxy]pyridine-2-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-5-[2-[3-(trifluoromethyl)phenyl]ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162546389 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-(cyclohexylmethyl)-5-[2-[3-(trifluoromethyl)phenyl]ethoxy]pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1ccc(OCCc2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C22H25F3N2O2/c23-22(24,25)18-8-4-7-16(13-18)11-12-29-19-9-10-20(26-15-19)21(28)27-14-17-5-2-1-3-6-17/h4,7-10,13,15,17H,1-3,5-6,11-12,14H2,(H,27,28) |
| InChIKey | HOKAQCJEKWSBCO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |