C18H17F3N2O3 — CID 71499319
N-(cyclopropylmethyl)-5-[[4-(trifluoromethoxy)phenoxy]methyl]pyridine-2-carboxamide (PubChem CID 71499319) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-[[4-(trifluoromethoxy)phenoxy]methyl]pyridine-2-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-5-[[4-(trifluoromethoxy)phenoxy]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71499319 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(cyclopropylmethyl)-5-[[4-(trifluoromethoxy)phenoxy]methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCC1CC1)c1ccc(COc2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C18H17F3N2O3/c19-18(20,21)26-15-6-4-14(5-7-15)25-11-13-3-8-16(22-10-13)17(24)23-9-12-1-2-12/h3-8,10,12H,1-2,9,11H2,(H,23,24) |
| InChIKey | IYQSNHBPYKXCHR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |