C19H24F2N2O4 — CID 162549070
4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-1-(2,2-dihydroxyethyl)piperidine-4-carbonitrile (PubChem CID 162549070) has the molecular formula C19H24F2N2O4 and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-1-(2,2-dihydroxyethyl)piperidine-4-carbonitrile.
| Compound Name | 4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-1-(2,2-dihydroxyethyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 162549070 |
| Molecular Formula | C19H24F2N2O4 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-1-(2,2-dihydroxyethyl)piperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccc(OC(F)F)c(OC3CCC3)c2)CCN(CC(O)O)CC1 |
| InChI | InChI=1S/C19H24F2N2O4/c20-18(21)27-15-5-4-13(10-16(15)26-14-2-1-3-14)19(12-22)6-8-23(9-7-19)11-17(24)25/h4-5,10,14,17-18,24-25H,1-3,6-9,11H2 |
| InChIKey | RXYYCCZSEOHGOR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|