C25H27F3N4O4S — CID 162550360
N-(5-carbamoyl-2-methoxyphenyl)-2-[1-[(E,2E)-2-ethylidene-3-(trifluoromethyl)pent-3-enoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 162550360) has the molecular formula C25H27F3N4O4S and a molecular weight of 536.58 g/mol. Its IUPAC name is N-(5-carbamoyl-2-methoxyphenyl)-2-[1-[(E,2E)-2-ethylidene-3-(trifluoromethyl)pent-3-enoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-carbamoyl-2-methoxyphenyl)-2-[1-[(E,2E)-2-ethylidene-3-(trifluoromethyl)pent-3-enoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162550360 |
| Molecular Formula | C25H27F3N4O4S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N-(5-carbamoyl-2-methoxyphenyl)-2-[1-[(E,2E)-2-ethylidene-3-(trifluoromethyl)pent-3-enoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C/C=C(C(=O)N1CCC(c2nc(C(=O)Nc3cc(C(N)=O)ccc3OC)cs2)CC1)\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C25H27F3N4O4S/c1-4-16(17(5-2)25(26,27)28)24(35)32-10-8-14(9-11-32)23-31-19(13-37-23)22(34)30-18-12-15(21(29)33)6-7-20(18)36-3/h4-7,12-14H,8-11H2,1-3H3,(H2,29,33)(H,30,34)/b16-4+,17-5+ |
| InChIKey | BFKYZAGLABQXDZ-KOVNFMEWSA-N |
| XLogP | 4.66 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|