C19H21ClF3NO4 — CID 162550390
2-(4-chlorophenyl)-1-[2-(1-hydroxyethylamino)ethoxy]-2-[3-(trifluoromethyl)phenoxy]ethanol (PubChem CID 162550390) has the molecular formula C19H21ClF3NO4 and a molecular weight of 419.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[2-(1-hydroxyethylamino)ethoxy]-2-[3-(trifluoromethyl)phenoxy]ethanol.
| Compound Name | 2-(4-chlorophenyl)-1-[2-(1-hydroxyethylamino)ethoxy]-2-[3-(trifluoromethyl)phenoxy]ethanol |
|---|---|
| PubChem CID | 162550390 |
| Molecular Formula | C19H21ClF3NO4 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[2-(1-hydroxyethylamino)ethoxy]-2-[3-(trifluoromethyl)phenoxy]ethanol |
| SMILES | CC(O)NCCOC(O)C(Oc1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClF3NO4/c1-12(25)24-9-10-27-18(26)17(13-5-7-15(20)8-6-13)28-16-4-2-3-14(11-16)19(21,22)23/h2-8,11-12,17-18,24-26H,9-10H2,1H3 |
| InChIKey | UAENGWALNIOXMH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|