C19H17ClF3NO4 — CID 18772295
[3-(trifluoromethyl)phenyl] 4-acetamido-2-(4-chlorophenyl)butaneperoxoate (PubChem CID 18772295) has the molecular formula C19H17ClF3NO4 and a molecular weight of 415.80 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 4-acetamido-2-(4-chlorophenyl)butaneperoxoate.
| Compound Name | [3-(trifluoromethyl)phenyl] 4-acetamido-2-(4-chlorophenyl)butaneperoxoate |
|---|---|
| PubChem CID | 18772295 |
| Molecular Formula | C19H17ClF3NO4 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 4-acetamido-2-(4-chlorophenyl)butaneperoxoate |
| SMILES | CC(=O)NCCC(C(=O)OOc1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClF3NO4/c1-12(25)24-10-9-17(13-5-7-15(20)8-6-13)18(26)28-27-16-4-2-3-14(11-16)19(21,22)23/h2-8,11,17H,9-10H2,1H3,(H,24,25) |
| InChIKey | CAEZJUGQUXRDRM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|