C22H25F2NO5S — CID 162550436
2-[4-(1,1-difluorobutyl)-2-(4-pyrrolidin-1-ylsulfonylphenyl)phenoxy]acetic acid (PubChem CID 162550436) has the molecular formula C22H25F2NO5S and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-[4-(1,1-difluorobutyl)-2-(4-pyrrolidin-1-ylsulfonylphenyl)phenoxy]acetic acid.
| Compound Name | 2-[4-(1,1-difluorobutyl)-2-(4-pyrrolidin-1-ylsulfonylphenyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 162550436 |
| Molecular Formula | C22H25F2NO5S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[4-(1,1-difluorobutyl)-2-(4-pyrrolidin-1-ylsulfonylphenyl)phenoxy]acetic acid |
| SMILES | CCCC(F)(F)c1ccc(OCC(=O)O)c(-c2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C22H25F2NO5S/c1-2-11-22(23,24)17-7-10-20(30-15-21(26)27)19(14-17)16-5-8-18(9-6-16)31(28,29)25-12-3-4-13-25/h5-10,14H,2-4,11-13,15H2,1H3,(H,26,27) |
| InChIKey | JGFJDRHCEQFTCB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |