C17H24F3N3O3S — CID 162550534
tert-butyl N-[3-[[2-sulfanylidene-2-[2-(trifluoromethoxy)anilino]ethyl]amino]propyl]carbamate (PubChem CID 162550534) has the molecular formula C17H24F3N3O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-sulfanylidene-2-[2-(trifluoromethoxy)anilino]ethyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-sulfanylidene-2-[2-(trifluoromethoxy)anilino]ethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 162550534 |
| Molecular Formula | C17H24F3N3O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | tert-butyl N-[3-[[2-sulfanylidene-2-[2-(trifluoromethoxy)anilino]ethyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCC(=S)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H24F3N3O3S/c1-16(2,3)26-15(24)22-10-6-9-21-11-14(27)23-12-7-4-5-8-13(12)25-17(18,19)20/h4-5,7-8,21H,6,9-11H2,1-3H3,(H,22,24)(H,23,27) |
| InChIKey | TUDGCEFQXPTCMM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|