C12H18F6INO — CID 162551967
1-[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxycyclohexyl]-N-iodomethanamine (PubChem CID 162551967) has the molecular formula C12H18F6INO and a molecular weight of 433.17 g/mol. Its IUPAC name is 1-[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxycyclohexyl]-N-iodomethanamine.
| Compound Name | 1-[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxycyclohexyl]-N-iodomethanamine |
|---|---|
| PubChem CID | 162551967 |
| Molecular Formula | C12H18F6INO |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 1-[5-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methoxycyclohexyl]-N-iodomethanamine |
| SMILES | COC1CCC(C(C)(C(F)(F)F)C(F)(F)F)CC1CNI |
| InChI | InChI=1S/C12H18F6INO/c1-10(11(13,14)15,12(16,17)18)8-3-4-9(21-2)7(5-8)6-20-19/h7-9,20H,3-6H2,1-2H3 |
| InChIKey | ICSUZSOLZVMEBU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|