C24H20F4N5O2+ — CID 162553002
1-[4-(2-fluoroethyl)-3-(trifluoromethyl)phenyl]-N-[4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)phenyl]aziridin-1-ium-1-carboxamide (PubChem CID 162553002) has the molecular formula C24H20F4N5O2+ and a molecular weight of 486.45 g/mol. Its IUPAC name is 1-[4-(2-fluoroethyl)-3-(trifluoromethyl)phenyl]-N-[4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)phenyl]aziridin-1-ium-1-carboxamide.
| Compound Name | 1-[4-(2-fluoroethyl)-3-(trifluoromethyl)phenyl]-N-[4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)phenyl]aziridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 162553002 |
| Molecular Formula | C24H20F4N5O2+ |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[4-(2-fluoroethyl)-3-(trifluoromethyl)phenyl]-N-[4-(1H-pyrazolo[3,4-b]pyridin-4-yloxy)phenyl]aziridin-1-ium-1-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc3[nH]ncc23)cc1)[N+]1(c2ccc(CCF)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H19F4N5O2/c25-9-7-15-1-4-17(13-20(15)24(26,27)28)33(11-12-33)23(34)31-16-2-5-18(6-3-16)35-21-8-10-29-22-19(21)14-30-32-22/h1-6,8,10,13-14H,7,9,11-12H2,(H-,29,30,31,32,34)/p+1 |
| InChIKey | JVDJCHSDNKVNTI-UHFFFAOYSA-O |
| XLogP | 5.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|