C24H20F4N4O3 — CID 67537822
1-[4-(3-fluoropropyl)-3-(trifluoromethyl)phenyl]-3-[4-(1-hydroxypyrrolo[2,3-b]pyridin-4-yl)oxyphenyl]urea (PubChem CID 67537822) has the molecular formula C24H20F4N4O3 and a molecular weight of 488.44 g/mol. Its IUPAC name is 1-[4-(3-fluoropropyl)-3-(trifluoromethyl)phenyl]-3-[4-(1-hydroxypyrrolo[2,3-b]pyridin-4-yl)oxyphenyl]urea.
| Compound Name | 1-[4-(3-fluoropropyl)-3-(trifluoromethyl)phenyl]-3-[4-(1-hydroxypyrrolo[2,3-b]pyridin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 67537822 |
| Molecular Formula | C24H20F4N4O3 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 1-[4-(3-fluoropropyl)-3-(trifluoromethyl)phenyl]-3-[4-(1-hydroxypyrrolo[2,3-b]pyridin-4-yl)oxyphenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccnc3c2ccn3O)cc1)Nc1ccc(CCCF)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F4N4O3/c25-11-1-2-15-3-4-17(14-20(15)24(26,27)28)31-23(33)30-16-5-7-18(8-6-16)35-21-9-12-29-22-19(21)10-13-32(22)34/h3-10,12-14,34H,1-2,11H2,(H2,30,31,33) |
| InChIKey | TWTLHYIOABKVPF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|