C9H15F3INO2 — CID 162553733
(1-iodo-2-methylpropan-2-yl) N-(1,1,1-trifluorobutan-2-yl)carbamate (PubChem CID 162553733) has the molecular formula C9H15F3INO2 and a molecular weight of 353.12 g/mol. Its IUPAC name is (1-iodo-2-methylpropan-2-yl) N-(1,1,1-trifluorobutan-2-yl)carbamate.
| Compound Name | (1-iodo-2-methylpropan-2-yl) N-(1,1,1-trifluorobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 162553733 |
| Molecular Formula | C9H15F3INO2 |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | (1-iodo-2-methylpropan-2-yl) N-(1,1,1-trifluorobutan-2-yl)carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)CI)C(F)(F)F |
| InChI | InChI=1S/C9H15F3INO2/c1-4-6(9(10,11)12)14-7(15)16-8(2,3)5-13/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | FUVRAVOERAJWHH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|