C26H25F5N6O3 — CID 162554632
N-[(3R)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(8-oxo-5,7,9-triazatricyclo[4.3.0.02,4]nona-1,3,6-trien-9-yl)piperidine-1-carboxamide (PubChem CID 162554632) has the molecular formula C26H25F5N6O3 and a molecular weight of 564.52 g/mol. Its IUPAC name is N-[(3R)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(8-oxo-5,7,9-triazatricyclo[4.3.0.02,4]nona-1,3,6-trien-9-yl)piperidine-1-carboxamide.
| Compound Name | N-[(3R)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(8-oxo-5,7,9-triazatricyclo[4.3.0.02,4]nona-1,3,6-trien-9-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 162554632 |
| Molecular Formula | C26H25F5N6O3 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[(3R)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(8-oxo-5,7,9-triazatricyclo[4.3.0.02,4]nona-1,3,6-trien-9-yl)piperidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCC(c2cccc(F)c2F)CN(CC(F)(F)F)C1=O)N1CCC(n2c(=O)nc3[nH]c4cc4c32)CC1 |
| InChI | InChI=1S/C26H25F5N6O3/c27-17-3-1-2-15(20(17)28)13-4-5-18(23(38)36(11-13)12-26(29,30)31)33-24(39)35-8-6-14(7-9-35)37-21-16-10-19(16)32-22(21)34-25(37)40/h1-3,10,13-14,18H,4-9,11-12H2,(H,33,39)(H,32,34,40)/t13?,18-/m1/s1 |
| InChIKey | IBANXDDEIFMYNE-PQJIZZRHSA-N |
| XLogP | 3.72 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |