C26H27F5N6O4 — CID 45487061
N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(4-hydroxy-2-oxoimidazo[4,5-b]pyridin-1-yl)piperidine-1-carboxamide (PubChem CID 45487061) has the molecular formula C26H27F5N6O4 and a molecular weight of 582.53 g/mol. Its IUPAC name is N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(4-hydroxy-2-oxoimidazo[4,5-b]pyridin-1-yl)piperidine-1-carboxamide.
| Compound Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(4-hydroxy-2-oxoimidazo[4,5-b]pyridin-1-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 45487061 |
| Molecular Formula | C26H27F5N6O4 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-4-(4-hydroxy-2-oxoimidazo[4,5-b]pyridin-1-yl)piperidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](c2cccc(F)c2F)CN(CC(F)(F)F)C1=O)N1CCC(n2c3cccn(O)c-3nc2=O)CC1 |
| InChI | InChI=1S/C26H27F5N6O4/c27-18-4-1-3-17(21(18)28)15-6-7-19(23(38)35(13-15)14-26(29,30)31)32-24(39)34-11-8-16(9-12-34)37-20-5-2-10-36(41)22(20)33-25(37)40/h1-5,10,15-16,19,41H,6-9,11-14H2,(H,32,39)/t15-,19-/m1/s1 |
| InChIKey | GGPOWNIGOYCQFL-DNVCBOLYSA-N |
| XLogP | 3.35 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|