C11H15F6I2NO3 — CID 162555071
[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-iodo-3-(iodoamino)-2-methylbutanoate (PubChem CID 162555071) has the molecular formula C11H15F6I2NO3 and a molecular weight of 577.04 g/mol. Its IUPAC name is [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-iodo-3-(iodoamino)-2-methylbutanoate.
| Compound Name | [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-iodo-3-(iodoamino)-2-methylbutanoate |
|---|---|
| PubChem CID | 162555071 |
| Molecular Formula | C11H15F6I2NO3 |
| Molecular Weight | 577.04 g/mol |
| Exact Mass | 576.90 |
| IUPAC Name | [5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 2-iodo-3-(iodoamino)-2-methylbutanoate |
| SMILES | CC(CC(O)(C(F)(F)F)C(F)(F)F)OC(=O)C(C)(I)C(C)NI |
| InChI | InChI=1S/C11H15F6I2NO3/c1-5(23-7(21)8(3,18)6(2)20-19)4-9(22,10(12,13)14)11(15,16)17/h5-6,20,22H,4H2,1-3H3 |
| InChIKey | FKKNPRUNJNHQLA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|