C8H8F6I2O3 — CID 154488634
[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-diiodo-2-methylpropanoate (PubChem CID 154488634) has the molecular formula C8H8F6I2O3 and a molecular weight of 519.95 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-diiodo-2-methylpropanoate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-diiodo-2-methylpropanoate |
|---|---|
| PubChem CID | 154488634 |
| Molecular Formula | C8H8F6I2O3 |
| Molecular Weight | 519.95 g/mol |
| Exact Mass | 519.85 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 2,3-diiodo-2-methylpropanoate |
| SMILES | CC(I)(CI)C(=O)OCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6I2O3/c1-5(16,2-15)4(17)19-3-6(18,7(9,10)11)8(12,13)14/h18H,2-3H2,1H3 |
| InChIKey | LAZIPTSCXFMVHO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|