C12H22F6O4Si — CID 91369761
propyl [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] carbonate;tetramethylsilane (PubChem CID 91369761) has the molecular formula C12H22F6O4Si and a molecular weight of 372.38 g/mol. Its IUPAC name is propyl [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] carbonate;tetramethylsilane.
| Compound Name | propyl [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] carbonate;tetramethylsilane |
|---|---|
| PubChem CID | 91369761 |
| Molecular Formula | C12H22F6O4Si |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | propyl [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] carbonate;tetramethylsilane |
| SMILES | CCCOC(=O)OCC(O)(C(F)(F)F)C(F)(F)F.C[Si](C)(C)C |
| InChI | InChI=1S/C8H10F6O4.C4H12Si/c1-2-3-17-5(15)18-4-6(16,7(9,10)11)8(12,13)14;1-5(2,3)4/h16H,2-4H2,1H3;1-4H3 |
| InChIKey | XHZMWICFZSPQAC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|