C24H22ClF3N6 — CID 162556541
(8S)-2-[(E)-2-[6-chloro-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 162556541) has the molecular formula C24H22ClF3N6 and a molecular weight of 486.93 g/mol. Its IUPAC name is (8S)-2-[(E)-2-[6-chloro-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (8S)-2-[(E)-2-[6-chloro-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 162556541 |
| Molecular Formula | C24H22ClF3N6 |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (8S)-2-[(E)-2-[6-chloro-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cn(-c2ccc(/C=C/c3nc4n(n3)CCC[C@H]4C3CC=CC=C3C(F)(F)F)nc2Cl)cn1 |
| InChI | InChI=1S/C24H22ClF3N6/c1-15-13-33(14-29-15)20-10-8-16(30-22(20)25)9-11-21-31-23-18(6-4-12-34(23)32-21)17-5-2-3-7-19(17)24(26,27)28/h2-3,7-11,13-14,17-18H,4-6,12H2,1H3/b11-9+/t17?,18-/m0/s1 |
| InChIKey | ZIHUNOPQUMASLS-HILZNKKTSA-N |
| XLogP | 5.93 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|