C25H27F3N6O9S2 — CID 66623621
2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine;sulfuric acid (PubChem CID 66623621) has the molecular formula C25H27F3N6O9S2 and a molecular weight of 676.65 g/mol. Its IUPAC name is 2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine;sulfuric acid.
| Compound Name | 2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine;sulfuric acid |
|---|---|
| PubChem CID | 66623621 |
| Molecular Formula | C25H27F3N6O9S2 |
| Molecular Weight | 676.65 g/mol |
| Exact Mass | 676.12 |
| IUPAC Name | 2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine;sulfuric acid |
| SMILES | COc1nc(C=Cc2nc3n(n2)CCCC3c2ccccc2C(F)(F)F)ccc1-n1cnc(C)c1.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C25H23F3N6O.2H2O4S/c1-16-14-33(15-29-16)21-11-9-17(30-24(21)35-2)10-12-22-31-23-19(7-5-13-34(23)32-22)18-6-3-4-8-20(18)25(26,27)28;2*1-5(2,3)4/h3-4,6,8-12,14-15,19H,5,7,13H2,1-2H3;2*(H2,1,2,3,4) |
| InChIKey | RLTAZSCFCMLHFD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 219.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|