C25H25FN6O — CID 66839580
8-[2-(fluoromethyl)phenyl]-2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 66839580) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is 8-[2-(fluoromethyl)phenyl]-2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-[2-(fluoromethyl)phenyl]-2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 66839580 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 8-[2-(fluoromethyl)phenyl]-2-[2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]ethenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1nc(C=Cc2nc3n(n2)CCCC3c2ccccc2CF)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H25FN6O/c1-17-15-31(16-27-17)22-11-9-19(28-25(22)33-2)10-12-23-29-24-21(8-5-13-32(24)30-23)20-7-4-3-6-18(20)14-26/h3-4,6-7,9-12,15-16,21H,5,8,13-14H2,1-2H3 |
| InChIKey | OMLPJPUPUJAVAV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |