C21H25BrF3IN2O3S — CID 162558920
tert-butyl N-[(4aR,6R)-8a-[5-bromo-2-(methylidene-λ3-iodanyl)phenyl]-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-N-methylcarbamate (PubChem CID 162558920) has the molecular formula C21H25BrF3IN2O3S and a molecular weight of 649.31 g/mol. Its IUPAC name is tert-butyl N-[(4aR,6R)-8a-[5-bromo-2-(methylidene-λ3-iodanyl)phenyl]-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(4aR,6R)-8a-[5-bromo-2-(methylidene-λ3-iodanyl)phenyl]-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 162558920 |
| Molecular Formula | C21H25BrF3IN2O3S |
| Molecular Weight | 649.31 g/mol |
| Exact Mass | 647.98 |
| IUPAC Name | tert-butyl N-[(4aR,6R)-8a-[5-bromo-2-(methylidene-λ3-iodanyl)phenyl]-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-N-methylcarbamate |
| SMILES | C=Ic1ccc(Br)cc1C12CO[C@@H](C(F)(F)F)C[C@H]1CSC(N(C)C(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C21H25BrF3IN2O3S/c1-19(2,3)31-18(29)28(5)17-27-20(14-9-13(22)6-7-15(14)26-4)11-30-16(21(23,24)25)8-12(20)10-32-17/h6-7,9,12,16H,4,8,10-11H2,1-3,5H3/t12-,16+,20?/m0/s1 |
| InChIKey | ZZVATVCQMJFBBM-SBIWBLFTSA-N |
| XLogP | 6.15 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|