C20H26F3IN2O3 — CID 162560698
2-cyclopropyl-N-[(6S)-6-(oxan-4-ylamino)-1λ3,3-iodoxan-1-yl]-4-(trifluoromethyl)benzamide (PubChem CID 162560698) has the molecular formula C20H26F3IN2O3 and a molecular weight of 526.34 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(6S)-6-(oxan-4-ylamino)-1λ3,3-iodoxan-1-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-cyclopropyl-N-[(6S)-6-(oxan-4-ylamino)-1λ3,3-iodoxan-1-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162560698 |
| Molecular Formula | C20H26F3IN2O3 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 2-cyclopropyl-N-[(6S)-6-(oxan-4-ylamino)-1λ3,3-iodoxan-1-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NI1COCC[C@H]1NC1CCOCC1)c1ccc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C20H26F3IN2O3/c21-20(22,23)14-3-4-16(17(11-14)13-1-2-13)19(27)26-24-12-29-10-7-18(24)25-15-5-8-28-9-6-15/h3-4,11,13,15,18,25H,1-2,5-10,12H2,(H,26,27)/t18-/m1/s1 |
| InChIKey | FDJXEAJVCOOKGT-GOSISDBHSA-N |
| XLogP | 4.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|