C10H20Cl2F2N2 — CID 162564095
6-N,6-N-dichloro-3,3-difluoro-1-N,1-N,6-trimethylheptane-1,6-diamine (PubChem CID 162564095) has the molecular formula C10H20Cl2F2N2 and a molecular weight of 277.19 g/mol. Its IUPAC name is 6-N,6-N-dichloro-3,3-difluoro-1-N,1-N,6-trimethylheptane-1,6-diamine.
| Compound Name | 6-N,6-N-dichloro-3,3-difluoro-1-N,1-N,6-trimethylheptane-1,6-diamine |
|---|---|
| PubChem CID | 162564095 |
| Molecular Formula | C10H20Cl2F2N2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 6-N,6-N-dichloro-3,3-difluoro-1-N,1-N,6-trimethylheptane-1,6-diamine |
| SMILES | CN(C)CCC(F)(F)CCC(C)(C)N(Cl)Cl |
| InChI | InChI=1S/C10H20Cl2F2N2/c1-9(2,16(11)12)5-6-10(13,14)7-8-15(3)4/h5-8H2,1-4H3 |
| InChIKey | MKYUVSIFAACISR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|