C9H18ClF3N2 — CID 162564092
2-N-chloro-1-N,2-N,2-trimethyl-1-N-(3,3,3-trifluoropropyl)propane-1,2-diamine (PubChem CID 162564092) has the molecular formula C9H18ClF3N2 and a molecular weight of 246.70 g/mol. Its IUPAC name is 2-N-chloro-1-N,2-N,2-trimethyl-1-N-(3,3,3-trifluoropropyl)propane-1,2-diamine.
| Compound Name | 2-N-chloro-1-N,2-N,2-trimethyl-1-N-(3,3,3-trifluoropropyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 162564092 |
| Molecular Formula | C9H18ClF3N2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-N-chloro-1-N,2-N,2-trimethyl-1-N-(3,3,3-trifluoropropyl)propane-1,2-diamine |
| SMILES | CN(CCC(F)(F)F)CC(C)(C)N(C)Cl |
| InChI | InChI=1S/C9H18ClF3N2/c1-8(2,15(4)10)7-14(3)6-5-9(11,12)13/h5-7H2,1-4H3 |
| InChIKey | JGNZDJSKROWIBZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|