C12H16F3N2O4- — CID 162564830
(2S)-1-ethoxy-2-[2-oxido-2-[4-(trifluoromethyl)phenoxy]hydrazinyl]propan-1-ol (PubChem CID 162564830) has the molecular formula C12H16F3N2O4- and a molecular weight of 309.26 g/mol. Its IUPAC name is (2S)-1-ethoxy-2-[2-oxido-2-[4-(trifluoromethyl)phenoxy]hydrazinyl]propan-1-ol.
| Compound Name | (2S)-1-ethoxy-2-[2-oxido-2-[4-(trifluoromethyl)phenoxy]hydrazinyl]propan-1-ol |
|---|---|
| PubChem CID | 162564830 |
| Molecular Formula | C12H16F3N2O4- |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2S)-1-ethoxy-2-[2-oxido-2-[4-(trifluoromethyl)phenoxy]hydrazinyl]propan-1-ol |
| SMILES | CCOC(O)[C@H](C)NN([O-])Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3N2O4/c1-3-20-11(18)8(2)16-17(19)21-10-6-4-9(5-7-10)12(13,14)15/h4-8,11,16,18H,3H2,1-2H3/q-1/t8-,11?/m0/s1 |
| InChIKey | IASGEHHNOBQTNB-YMNIQAILSA-N |
| XLogP | 2.05 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|