C25H29F3N6O3S — CID 162566814
[N-[3-[[(2R)-2-(4-methylpiperazin-1-yl)butanoyl]amino]-4-(trifluoromethoxy)benzoyl]carbamimidoyl] benzenecarboximidothioate (PubChem CID 162566814) has the molecular formula C25H29F3N6O3S and a molecular weight of 550.61 g/mol. Its IUPAC name is [N-[3-[[(2R)-2-(4-methylpiperazin-1-yl)butanoyl]amino]-4-(trifluoromethoxy)benzoyl]carbamimidoyl] benzenecarboximidothioate.
| Compound Name | [N-[3-[[(2R)-2-(4-methylpiperazin-1-yl)butanoyl]amino]-4-(trifluoromethoxy)benzoyl]carbamimidoyl] benzenecarboximidothioate |
|---|---|
| PubChem CID | 162566814 |
| Molecular Formula | C25H29F3N6O3S |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | [N-[3-[[(2R)-2-(4-methylpiperazin-1-yl)butanoyl]amino]-4-(trifluoromethoxy)benzoyl]carbamimidoyl] benzenecarboximidothioate |
| SMILES | [H]/N=C(/NC(=O)c1ccc(OC(F)(F)F)c(NC(=O)C(CC)N2CCN(C)CC2)c1)S/C(=N/[H])c1ccccc1 |
| InChI | InChI=1S/C25H29F3N6O3S/c1-3-19(34-13-11-33(2)12-14-34)23(36)31-18-15-17(9-10-20(18)37-25(26,27)28)22(35)32-24(30)38-21(29)16-7-5-4-6-8-16/h4-10,15,19,29H,3,11-14H2,1-2H3,(H,31,36)(H2,30,32,35)/b29-21+ |
| InChIKey | MGNOBFNESNTCHF-XHLNEMQHSA-N |
| XLogP | 3.97 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|