C22H24F3N5O2S — CID 162569519
[(7S)-2-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-7-methyl-1,2,5-oxadiazepan-5-yl]-[2-(1,3-thiazol-2-yl)phenyl]methanone (PubChem CID 162569519) has the molecular formula C22H24F3N5O2S and a molecular weight of 479.53 g/mol. Its IUPAC name is [(7S)-2-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-7-methyl-1,2,5-oxadiazepan-5-yl]-[2-(1,3-thiazol-2-yl)phenyl]methanone.
| Compound Name | [(7S)-2-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-7-methyl-1,2,5-oxadiazepan-5-yl]-[2-(1,3-thiazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 162569519 |
| Molecular Formula | C22H24F3N5O2S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [(7S)-2-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-7-methyl-1,2,5-oxadiazepan-5-yl]-[2-(1,3-thiazol-2-yl)phenyl]methanone |
| SMILES | C=C(C)/N=C(\C=C(/N)C(F)(F)F)N1CCN(C(=O)c2ccccc2-c2nccs2)C[C@H](C)O1 |
| InChI | InChI=1S/C22H24F3N5O2S/c1-14(2)28-19(12-18(26)22(23,24)25)30-10-9-29(13-15(3)32-30)21(31)17-7-5-4-6-16(17)20-27-8-11-33-20/h4-8,11-12,15H,1,9-10,13,26H2,2-3H3/b18-12-,28-19+/t15-/m0/s1 |
| InChIKey | UNANWJKSZJZXCH-FVNBGRDGSA-N |
| XLogP | 4.22 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|