C17H11NO2S — CID 141085725
1-phenyl-2-[2-(1,3-thiazol-2-yl)phenyl]ethane-1,2-dione (PubChem CID 141085725) has the molecular formula C17H11NO2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-phenyl-2-[2-(1,3-thiazol-2-yl)phenyl]ethane-1,2-dione.
| Compound Name | 1-phenyl-2-[2-(1,3-thiazol-2-yl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 141085725 |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-phenyl-2-[2-(1,3-thiazol-2-yl)phenyl]ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccccc1-c1nccs1)c1ccccc1 |
| InChI | InChI=1S/C17H11NO2S/c19-15(12-6-2-1-3-7-12)16(20)13-8-4-5-9-14(13)17-18-10-11-21-17/h1-11H |
| InChIKey | BQUGJGFUYCBPLK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|