5-bromo-2-(1,3-thiazol-2-yl)benzoic acid

C10H6BrNO2S — CID 169450844

IUPAC5-bromo-2-(1,3-thiazol-2-yl)benzoic acid
SMILESO=C(O)c1cc(Br)ccc1-c1nccs1
InChIInChI=1S/C10H6BrNO2S/c11-6-1-2-7(8(5-6)10(13)14)9-12-3-4-15-9/h1-5H,(H,13,14)
InChIKeyIWPZBXZZERUSPN-UHFFFAOYSA-N
MW284.13 g/mol
LogP3.27
Rot. Bonds2

About 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid

5-bromo-2-(1,3-thiazol-2-yl)benzoic acid (PubChem CID 169450844) has the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. Its IUPAC name is 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid.

Molecular Properties

Compound Name5-bromo-2-(1,3-thiazol-2-yl)benzoic acid
PubChem CID169450844
Molecular FormulaC10H6BrNO2S
Molecular Weight284.13 g/mol
Exact Mass282.93
IUPAC Name5-bromo-2-(1,3-thiazol-2-yl)benzoic acid
SMILESO=C(O)c1cc(Br)ccc1-c1nccs1
InChIInChI=1S/C10H6BrNO2S/c11-6-1-2-7(8(5-6)10(13)14)9-12-3-4-15-9/h1-5H,(H,13,14)
InChIKeyIWPZBXZZERUSPN-UHFFFAOYSA-N
XLogP3.27
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.13
LogP ≤ 53.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid?
The IUPAC name of 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid (CID 169450844) is 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid.
What is the SMILES notation for 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid?
The canonical SMILES for 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid is O=C(O)c1cc(Br)ccc1-c1nccs1.
What is the InChIKey of 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid?
The InChIKey is IWPZBXZZERUSPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrNO2S/c11-6-1-2-7(8(5-6)10(13)14)9-12-3-4-15-9/h1-5H,(H,13,14).
What are the key properties of 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid?
5-bromo-2-(1,3-thiazol-2-yl)benzoic acid has a molecular weight of 284.13 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1,3-thiazol-2-yl)benzoic acid is sourced from PubChem (CID 169450844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).