About 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid
3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid (PubChem CID 170992320) has the molecular formula C13H11NO3S
and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid |
| PubChem CID | 170992320 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nccs2)c(OC2CC2)c1 |
| InChI | InChI=1S/C13H11NO3S/c15-13(16)8-1-4-10(12-14-5-6-18-12)11(7-8)17-9-2-3-9/h1,4-7,9H,2-3H2,(H,15,16) |
| InChIKey | UONCFFVPHXUJJB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid?
The IUPAC name of 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid (CID 170992320) is 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid.
What is the SMILES notation for 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid?
The canonical SMILES for 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid is O=C(O)c1ccc(-c2nccs2)c(OC2CC2)c1.
What is the InChIKey of 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid?
The InChIKey is UONCFFVPHXUJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3S/c15-13(16)8-1-4-10(12-14-5-6-18-12)11(7-8)17-9-2-3-9/h1,4-7,9H,2-3H2,(H,15,16).
What are the key properties of 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid?
3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid has a molecular weight of 261.30 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-4-(1,3-thiazol-2-yl)benzoic acid is sourced from PubChem (CID 170992320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).