C24H25ClF2N4O5S2 — CID 162574059
[(1R,3S)-3-[[5-[[4-(7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl)thiophen-2-yl]-hydroxymethyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 162574059) has the molecular formula C24H25ClF2N4O5S2 and a molecular weight of 587.07 g/mol. Its IUPAC name is [(1R,3S)-3-[[5-[[4-(7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl)thiophen-2-yl]-hydroxymethyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,3S)-3-[[5-[[4-(7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl)thiophen-2-yl]-hydroxymethyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 162574059 |
| Molecular Formula | C24H25ClF2N4O5S2 |
| Molecular Weight | 587.07 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | [(1R,3S)-3-[[5-[[4-(7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl)thiophen-2-yl]-hydroxymethyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@@H]1CC[C@H](Nc2ncncc2C(O)c2cc(C3OCC(F)(F)c4ccc(Cl)cc43)cs2)C1 |
| InChI | InChI=1S/C24H25ClF2N4O5S2/c25-15-2-4-19-17(7-15)22(35-11-24(19,26)27)14-6-20(37-10-14)21(32)18-8-29-12-30-23(18)31-16-3-1-13(5-16)9-36-38(28,33)34/h2,4,6-8,10,12-13,16,21-22,32H,1,3,5,9,11H2,(H2,28,33,34)(H,29,30,31)/t13-,16+,21?,22?/m1/s1 |
| InChIKey | BGOYUOYFVPTUPY-DATMAEEJSA-N |
| XLogP | 4.29 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.07 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |