C16H13ClF3N3O3 — CID 162575617
methyl 2-[3-(4-chlorophenyl)-5-oxo-4-[2-(trifluoromethyl)but-3-ynyl]-1,2,4-triazol-1-yl]acetate (PubChem CID 162575617) has the molecular formula C16H13ClF3N3O3 and a molecular weight of 387.75 g/mol. Its IUPAC name is methyl 2-[3-(4-chlorophenyl)-5-oxo-4-[2-(trifluoromethyl)but-3-ynyl]-1,2,4-triazol-1-yl]acetate.
| Compound Name | methyl 2-[3-(4-chlorophenyl)-5-oxo-4-[2-(trifluoromethyl)but-3-ynyl]-1,2,4-triazol-1-yl]acetate |
|---|---|
| PubChem CID | 162575617 |
| Molecular Formula | C16H13ClF3N3O3 |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | methyl 2-[3-(4-chlorophenyl)-5-oxo-4-[2-(trifluoromethyl)but-3-ynyl]-1,2,4-triazol-1-yl]acetate |
| SMILES | C#CC(Cn1c(-c2ccc(Cl)cc2)nn(CC(=O)OC)c1=O)C(F)(F)F |
| InChI | InChI=1S/C16H13ClF3N3O3/c1-3-11(16(18,19)20)8-22-14(10-4-6-12(17)7-5-10)21-23(15(22)25)9-13(24)26-2/h1,4-7,11H,8-9H2,2H3 |
| InChIKey | SSRYWTCJEPGGRN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|