C21H21F3N4OS — CID 162576341
1-[1-[1-(phenylcarbamothioylamino)cyclopropyl]cyclopropyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 162576341) has the molecular formula C21H21F3N4OS and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-[1-[1-(phenylcarbamothioylamino)cyclopropyl]cyclopropyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-[1-(phenylcarbamothioylamino)cyclopropyl]cyclopropyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162576341 |
| Molecular Formula | C21H21F3N4OS |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[1-[1-(phenylcarbamothioylamino)cyclopropyl]cyclopropyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)NC1(C2(NC(=S)Nc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C21H21F3N4OS/c22-21(23,24)14-6-8-16(9-7-14)25-17(29)27-19(10-11-19)20(12-13-20)28-18(30)26-15-4-2-1-3-5-15/h1-9H,10-13H2,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | HKTKKWAIAZPIQW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|