C18H25F3O2 — CID 162576875
2,6-dimethyl-5-[[3-(trifluoromethoxy)phenyl]methyl]octan-3-one (PubChem CID 162576875) has the molecular formula C18H25F3O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2,6-dimethyl-5-[[3-(trifluoromethoxy)phenyl]methyl]octan-3-one.
| Compound Name | 2,6-dimethyl-5-[[3-(trifluoromethoxy)phenyl]methyl]octan-3-one |
|---|---|
| PubChem CID | 162576875 |
| Molecular Formula | C18H25F3O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2,6-dimethyl-5-[[3-(trifluoromethoxy)phenyl]methyl]octan-3-one |
| SMILES | CCC(C)C(CC(=O)C(C)C)Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F3O2/c1-5-13(4)15(11-17(22)12(2)3)9-14-7-6-8-16(10-14)23-18(19,20)21/h6-8,10,12-13,15H,5,9,11H2,1-4H3 |
| InChIKey | LXMROTMLNGMBQN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |