C19H19F3N4O4 — CID 162576913
(E)-3-[4-[[3-(diaminomethylamino)-5-(trifluoromethyl)benzoyl]amino]-2-methoxyphenyl]prop-2-enoic acid (PubChem CID 162576913) has the molecular formula C19H19F3N4O4 and a molecular weight of 424.38 g/mol. Its IUPAC name is (E)-3-[4-[[3-(diaminomethylamino)-5-(trifluoromethyl)benzoyl]amino]-2-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-(diaminomethylamino)-5-(trifluoromethyl)benzoyl]amino]-2-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162576913 |
| Molecular Formula | C19H19F3N4O4 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (E)-3-[4-[[3-(diaminomethylamino)-5-(trifluoromethyl)benzoyl]amino]-2-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(NC(=O)c2cc(NC(N)N)cc(C(F)(F)F)c2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C19H19F3N4O4/c1-30-15-9-13(4-2-10(15)3-5-16(27)28)25-17(29)11-6-12(19(20,21)22)8-14(7-11)26-18(23)24/h2-9,18,26H,23-24H2,1H3,(H,25,29)(H,27,28)/b5-3+ |
| InChIKey | HIBZISHUEBQLPA-HWKANZROSA-N |
| XLogP | 2.68 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|