C12H16F3NO2 — CID 162577167
5-(cyclopropen-1-yl)-6-(trifluoromethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol (PubChem CID 162577167) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 5-(cyclopropen-1-yl)-6-(trifluoromethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol.
| Compound Name | 5-(cyclopropen-1-yl)-6-(trifluoromethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
|---|---|
| PubChem CID | 162577167 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-(cyclopropen-1-yl)-6-(trifluoromethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
| SMILES | OC1CN2C(CCC(C(F)(F)F)C2C2=CC2)C1O |
| InChI | InChI=1S/C12H16F3NO2/c13-12(14,15)7-3-4-8-11(18)9(17)5-16(8)10(7)6-1-2-6/h1,7-11,17-18H,2-5H2 |
| InChIKey | RNIHZLVLFZLAFB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|