C29H26F3NO6S2 — CID 162579031
2-[(5Z)-5-[[4-[[6-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]methoxy]-3-(1-phenylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 162579031) has the molecular formula C29H26F3NO6S2 and a molecular weight of 605.66 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[[6-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]methoxy]-3-(1-phenylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[4-[[6-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]methoxy]-3-(1-phenylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 162579031 |
| Molecular Formula | C29H26F3NO6S2 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | 2-[(5Z)-5-[[4-[[6-methyl-4-(trifluoromethoxy)cyclohexa-1,3-dien-1-yl]methoxy]-3-(1-phenylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CC1CC(OC(F)(F)F)=CC=C1COc1ccc(/C=C2\SC(=S)N(CC(=O)O)C2=O)cc1OC(C)c1ccccc1 |
| InChI | InChI=1S/C29H26F3NO6S2/c1-17-12-22(39-29(30,31)32)10-9-21(17)16-37-23-11-8-19(13-24(23)38-18(2)20-6-4-3-5-7-20)14-25-27(36)33(15-26(34)35)28(40)41-25/h3-11,13-14,17-18H,12,15-16H2,1-2H3,(H,34,35)/b25-14- |
| InChIKey | UAHDUJHVTDGGFC-QFEZKATASA-N |
| XLogP | 6.88 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|