C35H30N2O6S2 — CID 85333209
2-[4-oxo-5-[[3-[2-oxo-1-phenyl-2-(2-phenylethylamino)ethoxy]-4-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 85333209) has the molecular formula C35H30N2O6S2 and a molecular weight of 638.77 g/mol. Its IUPAC name is 2-[4-oxo-5-[[3-[2-oxo-1-phenyl-2-(2-phenylethylamino)ethoxy]-4-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[4-oxo-5-[[3-[2-oxo-1-phenyl-2-(2-phenylethylamino)ethoxy]-4-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 85333209 |
| Molecular Formula | C35H30N2O6S2 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | 2-[4-oxo-5-[[3-[2-oxo-1-phenyl-2-(2-phenylethylamino)ethoxy]-4-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=Cc2ccc(OCc3ccccc3)c(OC(C(=O)NCCc3ccccc3)c3ccccc3)c2)SC1=S |
| InChI | InChI=1S/C35H30N2O6S2/c38-31(39)22-37-34(41)30(45-35(37)44)21-26-16-17-28(42-23-25-12-6-2-7-13-25)29(20-26)43-32(27-14-8-3-9-15-27)33(40)36-19-18-24-10-4-1-5-11-24/h1-17,20-21,32H,18-19,22-23H2,(H,36,40)(H,38,39) |
| InChIKey | OEPMCVBJONVSCS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|