C29H24F3NO4S2 — CID 89363373
(5Z)-3-(2-hydroxyprop-2-enyl)-5-[[4-(2-phenylethoxy)-3-(2,2,2-trifluoro-1-phenylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89363373) has the molecular formula C29H24F3NO4S2 and a molecular weight of 571.64 g/mol. Its IUPAC name is (5Z)-3-(2-hydroxyprop-2-enyl)-5-[[4-(2-phenylethoxy)-3-(2,2,2-trifluoro-1-phenylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-hydroxyprop-2-enyl)-5-[[4-(2-phenylethoxy)-3-(2,2,2-trifluoro-1-phenylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89363373 |
| Molecular Formula | C29H24F3NO4S2 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (5Z)-3-(2-hydroxyprop-2-enyl)-5-[[4-(2-phenylethoxy)-3-(2,2,2-trifluoro-1-phenylethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=C(O)CN1C(=O)/C(=C/c2ccc(OCCc3ccccc3)c(OC(c3ccccc3)C(F)(F)F)c2)SC1=S |
| InChI | InChI=1S/C29H24F3NO4S2/c1-19(34)18-33-27(35)25(39-28(33)38)17-21-12-13-23(36-15-14-20-8-4-2-5-9-20)24(16-21)37-26(29(30,31)32)22-10-6-3-7-11-22/h2-13,16-17,26,34H,1,14-15,18H2/b25-17- |
| InChIKey | AUZIDPHNDAROIQ-UQQQWYQISA-N |
| XLogP | 7.26 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|