C36H38N2O7S — CID 85338401
2-[5-[[3-[2-[cyclohexyl(ethyl)amino]-2-oxo-1-phenylethoxy]-4-(2-phenylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 85338401) has the molecular formula C36H38N2O7S and a molecular weight of 642.77 g/mol. Its IUPAC name is 2-[5-[[3-[2-[cyclohexyl(ethyl)amino]-2-oxo-1-phenylethoxy]-4-(2-phenylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[[3-[2-[cyclohexyl(ethyl)amino]-2-oxo-1-phenylethoxy]-4-(2-phenylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 85338401 |
| Molecular Formula | C36H38N2O7S |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 2-[5-[[3-[2-[cyclohexyl(ethyl)amino]-2-oxo-1-phenylethoxy]-4-(2-phenylethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN(C(=O)C(Oc1cc(C=C2SC(=O)N(CC(=O)O)C2=O)ccc1OCCc1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C36H38N2O7S/c1-2-37(28-16-10-5-11-17-28)35(42)33(27-14-8-4-9-15-27)45-30-22-26(23-31-34(41)38(24-32(39)40)36(43)46-31)18-19-29(30)44-21-20-25-12-6-3-7-13-25/h3-4,6-9,12-15,18-19,22-23,28,33H,2,5,10-11,16-17,20-21,24H2,1H3,(H,39,40) |
| InChIKey | KEZAYYCWTBKSCV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|