C33H32FNO5S2 — CID 58205937
[(5Z)-5-[[3-[cyclohexyl(phenyl)methoxy]-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate (PubChem CID 58205937) has the molecular formula C33H32FNO5S2 and a molecular weight of 605.75 g/mol. Its IUPAC name is [(5Z)-5-[[3-[cyclohexyl(phenyl)methoxy]-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate.
| Compound Name | [(5Z)-5-[[3-[cyclohexyl(phenyl)methoxy]-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 58205937 |
| Molecular Formula | C33H32FNO5S2 |
| Molecular Weight | 605.75 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | [(5Z)-5-[[3-[cyclohexyl(phenyl)methoxy]-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
| SMILES | O=COCN1C(=O)/C(=C/c2ccc(OCCc3ccc(F)cc3)c(OC(c3ccccc3)C3CCCCC3)c2)SC1=S |
| InChI | InChI=1S/C33H32FNO5S2/c34-27-14-11-23(12-15-27)17-18-39-28-16-13-24(20-30-32(37)35(21-38-22-36)33(41)42-30)19-29(28)40-31(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1,3-4,7-8,11-16,19-20,22,26,31H,2,5-6,9-10,17-18,21H2/b30-20- |
| InChIKey | KFPICTSPQJXJGF-COEJQBHMSA-N |
| XLogP | 7.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|