C31H30FNO7S2 — CID 76702157
[5-[[3-(1,3-dimethoxy-2-phenylpropan-2-yl)oxy-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate (PubChem CID 76702157) has the molecular formula C31H30FNO7S2 and a molecular weight of 611.71 g/mol. Its IUPAC name is [5-[[3-(1,3-dimethoxy-2-phenylpropan-2-yl)oxy-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate.
| Compound Name | [5-[[3-(1,3-dimethoxy-2-phenylpropan-2-yl)oxy-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 76702157 |
| Molecular Formula | C31H30FNO7S2 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | [5-[[3-(1,3-dimethoxy-2-phenylpropan-2-yl)oxy-4-[2-(4-fluorophenyl)ethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
| SMILES | COCC(COC)(Oc1cc(C=C2SC(=S)N(COC=O)C2=O)ccc1OCCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H30FNO7S2/c1-36-18-31(19-37-2,24-6-4-3-5-7-24)40-27-16-23(17-28-29(35)33(20-38-21-34)30(41)42-28)10-13-26(27)39-15-14-22-8-11-25(32)12-9-22/h3-13,16-17,21H,14-15,18-20H2,1-2H3 |
| InChIKey | YBFPZJMOKPIPJF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|