C27H20F3NO5S2 — CID 6479733
2-[(5Z)-4-oxo-5-[[3-phenylmethoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 6479733) has the molecular formula C27H20F3NO5S2 and a molecular weight of 559.59 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-5-[[3-phenylmethoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-4-oxo-5-[[3-phenylmethoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 6479733 |
| Molecular Formula | C27H20F3NO5S2 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 2-[(5Z)-4-oxo-5-[[3-phenylmethoxy-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C/c2ccc(OCc3ccc(C(F)(F)F)cc3)c(OCc3ccccc3)c2)SC1=S |
| InChI | InChI=1S/C27H20F3NO5S2/c28-27(29,30)20-9-6-18(7-10-20)16-35-21-11-8-19(12-22(21)36-15-17-4-2-1-3-5-17)13-23-25(34)31(14-24(32)33)26(37)38-23/h1-13H,14-16H2,(H,32,33)/b23-13- |
| InChIKey | KWYBOLDSAURJIK-QRVIBDJDSA-N |
| XLogP | 6.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|