C20H18F2N2O3S — CID 162580040
N-benzyl-4-(1,1-difluorobut-3-enyl)-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 162580040) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-benzyl-4-(1,1-difluorobut-3-enyl)-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-benzyl-4-(1,1-difluorobut-3-enyl)-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 162580040 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-benzyl-4-(1,1-difluorobut-3-enyl)-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | C=CCC(F)(F)c1cc(=O)[nH]c2ccc(S(=O)(=O)NCc3ccccc3)cc12 |
| InChI | InChI=1S/C20H18F2N2O3S/c1-2-10-20(21,22)17-12-19(25)24-18-9-8-15(11-16(17)18)28(26,27)23-13-14-6-4-3-5-7-14/h2-9,11-12,23H,1,10,13H2,(H,24,25) |
| InChIKey | LHEWOCDMJUXBSX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|