C27H25F3N2O4 — CID 162581058
2-methyl-2-[4-[1-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]ethoxy]phenoxy]butanoic acid (PubChem CID 162581058) has the molecular formula C27H25F3N2O4 and a molecular weight of 498.50 g/mol. Its IUPAC name is 2-methyl-2-[4-[1-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]ethoxy]phenoxy]butanoic acid.
| Compound Name | 2-methyl-2-[4-[1-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]ethoxy]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 162581058 |
| Molecular Formula | C27H25F3N2O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 2-methyl-2-[4-[1-[1-[4-(trifluoromethyl)phenyl]indazol-4-yl]ethoxy]phenoxy]butanoic acid |
| SMILES | CCC(C)(Oc1ccc(OC(C)c2cccc3c2cnn3-c2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H25F3N2O4/c1-4-26(3,25(33)34)36-21-14-12-20(13-15-21)35-17(2)22-6-5-7-24-23(22)16-31-32(24)19-10-8-18(9-11-19)27(28,29)30/h5-17H,4H2,1-3H3,(H,33,34) |
| InChIKey | CNTFTACMLPGLSQ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |