C25H21F3N2O4 — CID 68858218
2-[4-[1H-indazol-4-yl-[4-(trifluoromethyl)phenyl]methoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 68858218) has the molecular formula C25H21F3N2O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is 2-[4-[1H-indazol-4-yl-[4-(trifluoromethyl)phenyl]methoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[1H-indazol-4-yl-[4-(trifluoromethyl)phenyl]methoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68858218 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[4-[1H-indazol-4-yl-[4-(trifluoromethyl)phenyl]methoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(OC(c2ccc(C(F)(F)F)cc2)c2cccc3[nH]ncc23)cc1)C(=O)O |
| InChI | InChI=1S/C25H21F3N2O4/c1-24(2,23(31)32)34-18-12-10-17(11-13-18)33-22(15-6-8-16(9-7-15)25(26,27)28)19-4-3-5-21-20(19)14-29-30-21/h3-14,22H,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | GOSGUUXPYWDQTG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |